C21H23ClN4OS — CID 4570004
1-[(2-chlorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)thiourea (PubChem CID 4570004) has the molecular formula C21H23ClN4OS and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4570004 |
| Molecular Formula | C21H23ClN4OS |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(CCCn2ccnc2)Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H23ClN4OS/c1-27-19-8-4-7-18(14-19)24-21(28)26(12-5-11-25-13-10-23-16-25)15-17-6-2-3-9-20(17)22/h2-4,6-10,13-14,16H,5,11-12,15H2,1H3,(H,24,28) |
| InChIKey | FYVUJFMLVFQJGI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|