C21H22ClFN4OS — CID 4205095
3-(2-chloro-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 4205095) has the molecular formula C21H22ClFN4OS and a molecular weight of 432.95 g/mol. Its IUPAC name is 3-(2-chloro-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 3-(2-chloro-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4205095 |
| Molecular Formula | C21H22ClFN4OS |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3-(2-chloro-4-methoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCCn2ccnc2)Cc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H22ClFN4OS/c1-28-18-6-7-20(19(22)13-18)25-21(29)27(10-3-9-26-11-8-24-15-26)14-16-4-2-5-17(23)12-16/h2,4-8,11-13,15H,3,9-10,14H2,1H3,(H,25,29) |
| InChIKey | YQBIAIHSTFSJAR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|