C23H25ClF3N5S — CID 5105028
3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 5105028) has the molecular formula C23H25ClF3N5S and a molecular weight of 496.00 g/mol. Its IUPAC name is 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 5105028 |
| Molecular Formula | C23H25ClF3N5S |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | CN(C)c1ccc(CN(CCCn2ccnc2)C(=S)Nc2ccc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C23H25ClF3N5S/c1-30(2)19-7-4-17(5-8-19)15-32(12-3-11-31-13-10-28-16-31)22(33)29-21-9-6-18(14-20(21)24)23(25,26)27/h4-10,13-14,16H,3,11-12,15H2,1-2H3,(H,29,33) |
| InChIKey | KWTAIUHEWNPBGM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|