C26H34ClF3N4S — CID 44668869
3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 44668869) has the molecular formula C26H34ClF3N4S and a molecular weight of 527.10 g/mol. Its IUPAC name is 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 44668869 |
| Molecular Formula | C26H34ClF3N4S |
| Molecular Weight | 527.10 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CN(C)c1ccc(CN(C(=S)Nc2ccc(C(F)(F)F)cc2Cl)C2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H34ClF3N4S/c1-24(2)14-20(15-25(3,4)32-24)34(16-17-7-10-19(11-8-17)33(5)6)23(35)31-22-12-9-18(13-21(22)27)26(28,29)30/h7-13,20,32H,14-16H2,1-6H3,(H,31,35) |
| InChIKey | QLEARZOLJFQBKK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.10 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|