C22H25ClF3N3O2S — CID 3646312
3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 3646312) has the molecular formula C22H25ClF3N3O2S and a molecular weight of 487.98 g/mol. Its IUPAC name is 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 3646312 |
| Molecular Formula | C22H25ClF3N3O2S |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 3-[2-chloro-4-(trifluoromethyl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(CN(CCN2CCOCC2)C(=S)Nc2ccc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C22H25ClF3N3O2S/c1-30-18-5-2-16(3-6-18)15-29(9-8-28-10-12-31-13-11-28)21(32)27-20-7-4-17(14-19(20)23)22(24,25)26/h2-7,14H,8-13,15H2,1H3,(H,27,32) |
| InChIKey | XJODWOGCWDBTKI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|