C23H30ClN3O4S — CID 23097864
3-(5-chloro-2-methoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 23097864) has the molecular formula C23H30ClN3O4S and a molecular weight of 480.03 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 23097864 |
| Molecular Formula | C23H30ClN3O4S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)N(CCN1CCOCC1)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30ClN3O4S/c1-28-20-7-5-18(24)15-19(20)25-23(32)27(9-8-26-10-12-31-13-11-26)16-17-4-6-21(29-2)22(14-17)30-3/h4-7,14-15H,8-13,16H2,1-3H3,(H,25,32) |
| InChIKey | DKPQZLRDTSSCMI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|