C22H37N3O3S — CID 5066646
1-[(3,4-dimethoxyphenyl)methyl]-3-hexyl-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 5066646) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-hexyl-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-hexyl-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 5066646 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-hexyl-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCCCCCNC(=S)N(CCN1CCOCC1)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H37N3O3S/c1-4-5-6-7-10-23-22(29)25(12-11-24-13-15-28-16-14-24)18-19-8-9-20(26-2)21(17-19)27-3/h8-9,17H,4-7,10-16,18H2,1-3H3,(H,23,29) |
| InChIKey | GCPQJCUHKYZMRA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|