C25H42N4O3S — CID 17065944
1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065944) has the molecular formula C25H42N4O3S and a molecular weight of 478.70 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065944 |
| Molecular Formula | C25H42N4O3S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-1-(2-morpholin-4-ylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | COc1ccc(CN(CCN2CCOCC2)C(=S)NC2CC(C)(C)NC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C25H42N4O3S/c1-24(2)16-20(17-25(3,4)27-24)26-23(33)29(10-9-28-11-13-32-14-12-28)18-19-7-8-21(30-5)22(15-19)31-6/h7-8,15,20,27H,9-14,16-18H2,1-6H3,(H,26,33) |
| InChIKey | JNNAPAZVJZFPIX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|