C25H34FN3OS — CID 17065876
1-[(3-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065876) has the molecular formula C25H34FN3OS and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065876 |
| Molecular Formula | C25H34FN3OS |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | COc1ccc(CN(Cc2cccc(F)c2)C(=S)NC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H34FN3OS/c1-24(2)14-21(15-25(3,4)28-24)27-23(31)29(17-19-7-6-8-20(26)13-19)16-18-9-11-22(30-5)12-10-18/h6-13,21,28H,14-17H2,1-5H3,(H,27,31) |
| InChIKey | AOXLZAMYKXRJSJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|