C23H31FN4S — CID 17065763
1-[(4-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065763) has the molecular formula C23H31FN4S and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065763 |
| Molecular Formula | C23H31FN4S |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)N(Cc2ccc(F)cc2)Cc2cccnc2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H31FN4S/c1-22(2)12-20(13-23(3,4)27-22)26-21(29)28(16-18-6-5-11-25-14-18)15-17-7-9-19(24)10-8-17/h5-11,14,20,27H,12-13,15-16H2,1-4H3,(H,26,29) |
| InChIKey | CMXMFZJSISYWDV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|