C20H31N3S — CID 17066055
1-benzyl-1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17066055) has the molecular formula C20H31N3S and a molecular weight of 345.56 g/mol. Its IUPAC name is 1-benzyl-1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-benzyl-1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17066055 |
| Molecular Formula | C20H31N3S |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-benzyl-1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | C=CCN(Cc1ccccc1)C(=S)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H31N3S/c1-6-12-23(15-16-10-8-7-9-11-16)18(24)21-17-13-19(2,3)22-20(4,5)14-17/h6-11,17,22H,1,12-15H2,2-5H3,(H,21,24) |
| InChIKey | OQBMECKMAJRPTB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|