C21H33N3O2S — CID 17066026
ethyl 2-[benzyl-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioyl]amino]acetate (PubChem CID 17066026) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioyl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioyl]amino]acetate |
|---|---|
| PubChem CID | 17066026 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethyl 2-[benzyl-[(2,2,6,6-tetramethylpiperidin-4-yl)carbamothioyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)C(=S)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H33N3O2S/c1-6-26-18(25)15-24(14-16-10-8-7-9-11-16)19(27)22-17-12-20(2,3)23-21(4,5)13-17/h7-11,17,23H,6,12-15H2,1-5H3,(H,22,27) |
| InChIKey | RZEHNBWJQSBLFE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|