C24H35N3OS — CID 17066000
1-[(5-methylfuran-2-yl)methyl]-1-(2-phenylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17066000) has the molecular formula C24H35N3OS and a molecular weight of 413.63 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-1-(2-phenylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-1-(2-phenylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17066000 |
| Molecular Formula | C24H35N3OS |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-1-(2-phenylethyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | Cc1ccc(CN(CCc2ccccc2)C(=S)NC2CC(C)(C)NC(C)(C)C2)o1 |
| InChI | InChI=1S/C24H35N3OS/c1-18-11-12-21(28-18)17-27(14-13-19-9-7-6-8-10-19)22(29)25-20-15-23(2,3)26-24(4,5)16-20/h6-12,20,26H,13-17H2,1-5H3,(H,25,29) |
| InChIKey | YHYDSEKSKZCUMG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|