C22H37N3OS — CID 17065938
1-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17065938) has the molecular formula C22H37N3OS and a molecular weight of 391.63 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17065938 |
| Molecular Formula | C22H37N3OS |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 1-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | Cc1ccc(CN(C(=S)NC2CC(C)(C)NC(C)(C)C2)C2CCCCC2)o1 |
| InChI | InChI=1S/C22H37N3OS/c1-16-11-12-19(26-16)15-25(18-9-7-6-8-10-18)20(27)23-17-13-21(2,3)24-22(4,5)14-17/h11-12,17-18,24H,6-10,13-15H2,1-5H3,(H,23,27) |
| InChIKey | TWAUAOPGMGPMGK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|