C23H38N4S — CID 17383941
3-cycloheptyl-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17383941) has the molecular formula C23H38N4S and a molecular weight of 402.65 g/mol. Its IUPAC name is 3-cycloheptyl-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 3-cycloheptyl-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17383941 |
| Molecular Formula | C23H38N4S |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 3-cycloheptyl-1-(pyridin-3-ylmethyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(N(Cc2cccnc2)C(=S)NC2CCCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H38N4S/c1-22(2)14-20(15-23(3,4)26-22)27(17-18-10-9-13-24-16-18)21(28)25-19-11-7-5-6-8-12-19/h9-10,13,16,19-20,26H,5-8,11-12,14-15,17H2,1-4H3,(H,25,28) |
| InChIKey | SHQHDVIQNGWZLX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|