C17H25N3O2S2 — CID 51430350
3-cyclohexyl-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 51430350) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-cyclohexyl-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 51430350 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-cyclohexyl-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | O=S1(=O)CC[C@@H](N(Cc2cccnc2)C(=S)NC2CCCCC2)C1 |
| InChI | InChI=1S/C17H25N3O2S2/c21-24(22)10-8-16(13-24)20(12-14-5-4-9-18-11-14)17(23)19-15-6-2-1-3-7-15/h4-5,9,11,15-16H,1-3,6-8,10,12-13H2,(H,19,23)/t16-/m1/s1 |
| InChIKey | XVMZLGPQVHELEG-MRXNPFEDSA-N |
| XLogP | 2.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|