C12H22N2O2S2 — CID 115573005
3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea (PubChem CID 115573005) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea.
| Compound Name | 3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea |
|---|---|
| PubChem CID | 115573005 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-cyclohexyl-1-(1,1-dioxothiolan-3-yl)-1-methylthiourea |
| SMILES | CN(C(=S)NC1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N2O2S2/c1-14(11-7-8-18(15,16)9-11)12(17)13-10-5-3-2-4-6-10/h10-11H,2-9H2,1H3,(H,13,17) |
| InChIKey | BLIKTYHXNFFSCN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|