C10H18N2O2S2 — CID 16564052
1-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylprop-2-enyl)thiourea (PubChem CID 16564052) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 16564052 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-methyl-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O2S2/c1-8(2)6-11-10(15)12(3)9-4-5-16(13,14)7-9/h9H,1,4-7H2,2-3H3,(H,11,15) |
| InChIKey | ZFLCVWCUTRSJOY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|