C13H22N2O6S2 — CID 108949171
N,N'-bis(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide (PubChem CID 108949171) has the molecular formula C13H22N2O6S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N,N'-bis(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide.
| Compound Name | N,N'-bis(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 108949171 |
| Molecular Formula | C13H22N2O6S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N,N'-bis(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide |
| SMILES | CN(C(=O)CC(=O)N(C)C1CCS(=O)(=O)C1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O6S2/c1-14(10-3-5-22(18,19)8-10)12(16)7-13(17)15(2)11-4-6-23(20,21)9-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | HFDDWPZEPRCEIZ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|