C16H22N2O4S — CID 108946053
N-benzyl-N'-(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide (PubChem CID 108946053) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-benzyl-N'-(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide.
| Compound Name | N-benzyl-N'-(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide |
|---|---|
| PubChem CID | 108946053 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-benzyl-N'-(1,1-dioxothiolan-3-yl)-N,N'-dimethylpropanediamide |
| SMILES | CN(Cc1ccccc1)C(=O)CC(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O4S/c1-17(11-13-6-4-3-5-7-13)15(19)10-16(20)18(2)14-8-9-23(21,22)12-14/h3-7,14H,8-12H2,1-2H3 |
| InChIKey | GCFNAXXKVLLUAR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|