C14H19NO5S2 — CID 110294969
3-(benzenesulfonyl)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide (PubChem CID 110294969) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 110294969 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
| SMILES | CN(C(=O)CCS(=O)(=O)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO5S2/c1-15(12-7-9-21(17,18)11-12)14(16)8-10-22(19,20)13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3 |
| InChIKey | UFFDKIFQHROUCQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |