C16H24N2O4S — CID 109026654
N-(1,1-dioxothiolan-3-yl)-3-(2-ethoxyanilino)-N-methylpropanamide (PubChem CID 109026654) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(2-ethoxyanilino)-N-methylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(2-ethoxyanilino)-N-methylpropanamide |
|---|---|
| PubChem CID | 109026654 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(2-ethoxyanilino)-N-methylpropanamide |
| SMILES | CCOc1ccccc1NCCC(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24N2O4S/c1-3-22-15-7-5-4-6-14(15)17-10-8-16(19)18(2)13-9-11-23(20,21)12-13/h4-7,13,17H,3,8-12H2,1-2H3 |
| InChIKey | FTLRQQNNWJUVTN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |