C18H26N2O5S — CID 108964769
N-(1,1-dioxothiolan-3-yl)-N'-(2-ethoxyphenyl)-N,2,2-trimethylpropanediamide (PubChem CID 108964769) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-(2-ethoxyphenyl)-N,2,2-trimethylpropanediamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-(2-ethoxyphenyl)-N,2,2-trimethylpropanediamide |
|---|---|
| PubChem CID | 108964769 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-(2-ethoxyphenyl)-N,2,2-trimethylpropanediamide |
| SMILES | CCOc1ccccc1NC(=O)C(C)(C)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26N2O5S/c1-5-25-15-9-7-6-8-14(15)19-16(21)18(2,3)17(22)20(4)13-10-11-26(23,24)12-13/h6-9,13H,5,10-12H2,1-4H3,(H,19,21) |
| InChIKey | CXMSDKDYPJHOER-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|