C17H23FN2O4S — CID 108965263
N-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-fluorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108965263) has the molecular formula C17H23FN2O4S and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-fluorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-fluorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965263 |
| Molecular Formula | C17H23FN2O4S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-fluorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)Nc1ccccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23FN2O4S/c1-4-20(12-9-10-25(23,24)11-12)16(22)17(2,3)15(21)19-14-8-6-5-7-13(14)18/h5-8,12H,4,9-11H2,1-3H3,(H,19,21) |
| InChIKey | QMPBKOFSFIUMAZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|