C15H18F2N2O4S — CID 108950205
N-(2,6-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide (PubChem CID 108950205) has the molecular formula C15H18F2N2O4S and a molecular weight of 360.38 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide.
| Compound Name | N-(2,6-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108950205 |
| Molecular Formula | C15H18F2N2O4S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-(2,6-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
| SMILES | CCN(C(=O)CC(=O)Nc1c(F)cccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18F2N2O4S/c1-2-19(10-6-7-24(22,23)9-10)14(21)8-13(20)18-15-11(16)4-3-5-12(15)17/h3-5,10H,2,6-9H2,1H3,(H,18,20) |
| InChIKey | ZHNQEXCSXQCMNF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|