C14H17FN2O4S — CID 108949267
N'-(1,1-dioxothiolan-3-yl)-N-(3-fluorophenyl)-N'-methylpropanediamide (PubChem CID 108949267) has the molecular formula C14H17FN2O4S and a molecular weight of 328.37 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-(3-fluorophenyl)-N'-methylpropanediamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-(3-fluorophenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108949267 |
| Molecular Formula | C14H17FN2O4S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-(3-fluorophenyl)-N'-methylpropanediamide |
| SMILES | CN(C(=O)CC(=O)Nc1cccc(F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17FN2O4S/c1-17(12-5-6-22(20,21)9-12)14(19)8-13(18)16-11-4-2-3-10(15)7-11/h2-4,7,12H,5-6,8-9H2,1H3,(H,16,18) |
| InChIKey | KKMQSKULFQASFP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|