C14H16Cl2N2O4S — CID 108949278
N-(2,4-dichlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methylpropanediamide (PubChem CID 108949278) has the molecular formula C14H16Cl2N2O4S and a molecular weight of 379.27 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methylpropanediamide.
| Compound Name | N-(2,4-dichlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108949278 |
| Molecular Formula | C14H16Cl2N2O4S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methylpropanediamide |
| SMILES | CN(C(=O)CC(=O)Nc1ccc(Cl)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16Cl2N2O4S/c1-18(10-4-5-23(21,22)8-10)14(20)7-13(19)17-12-3-2-9(15)6-11(12)16/h2-3,6,10H,4-5,7-8H2,1H3,(H,17,19) |
| InChIKey | BPVSWQOZDYNDQA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|