C20H30N2O4S — CID 108949272
N'-(1,1-dioxothiolan-3-yl)-N-[2,6-di(propan-2-yl)phenyl]-N'-methylpropanediamide (PubChem CID 108949272) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-[2,6-di(propan-2-yl)phenyl]-N'-methylpropanediamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-[2,6-di(propan-2-yl)phenyl]-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108949272 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-[2,6-di(propan-2-yl)phenyl]-N'-methylpropanediamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CC(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H30N2O4S/c1-13(2)16-7-6-8-17(14(3)4)20(16)21-18(23)11-19(24)22(5)15-9-10-27(25,26)12-15/h6-8,13-15H,9-12H2,1-5H3,(H,21,23) |
| InChIKey | ZCWNEUOUBKKMKG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|