C13H16FNO4S — CID 110755800
N-(1,1-dioxothiolan-3-yl)-2-(3-fluorophenoxy)-N-methylacetamide (PubChem CID 110755800) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(3-fluorophenoxy)-N-methylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(3-fluorophenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 110755800 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(3-fluorophenoxy)-N-methylacetamide |
| SMILES | CN(C(=O)COc1cccc(F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16FNO4S/c1-15(11-5-6-20(17,18)9-11)13(16)8-19-12-4-2-3-10(14)7-12/h2-4,7,11H,5-6,8-9H2,1H3 |
| InChIKey | FIASNRBZFIFHKN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |