C12H14FNO4S — CID 7834521
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-fluorophenoxy)acetamide (PubChem CID 7834521) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-fluorophenoxy)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 7834521 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-fluorophenoxy)acetamide |
| SMILES | O=C(COc1cccc(F)c1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14FNO4S/c13-9-2-1-3-11(6-9)18-7-12(15)14-10-4-5-19(16,17)8-10/h1-3,6,10H,4-5,7-8H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | QOCKCFIDYCYOBR-SNVBAGLBSA-N |
| XLogP | 0.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |