C14H13F6NO4S — CID 78544557
2-[3,5-bis(trifluoromethyl)phenoxy]-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 78544557) has the molecular formula C14H13F6NO4S and a molecular weight of 405.32 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 78544557 |
| Molecular Formula | C14H13F6NO4S |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(COc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H13F6NO4S/c15-13(16,17)8-3-9(14(18,19)20)5-11(4-8)25-6-12(22)21-10-1-2-26(23,24)7-10/h3-5,10H,1-2,6-7H2,(H,21,22) |
| InChIKey | BWYYXLYKTRBTFS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |