C12H11F4NO4S — CID 11947642
N-(1,1-dioxothiolan-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 11947642) has the molecular formula C12H11F4NO4S and a molecular weight of 341.28 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 11947642 |
| Molecular Formula | C12H11F4NO4S |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | O=C(COc1c(F)c(F)cc(F)c1F)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H11F4NO4S/c13-7-3-8(14)11(16)12(10(7)15)21-4-9(18)17-6-1-2-22(19,20)5-6/h3,6H,1-2,4-5H2,(H,17,18) |
| InChIKey | JDZAGGBFHZUZMC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|