C13H12ClF2NO5S — CID 3974385
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 3974385) has the molecular formula C13H12ClF2NO5S and a molecular weight of 367.76 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 3974385 |
| Molecular Formula | C13H12ClF2NO5S |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H12ClF2NO5S/c14-9-4-11(16)10(15)3-8(9)13(19)22-5-12(18)17-7-1-2-23(20,21)6-7/h3-4,7H,1-2,5-6H2,(H,17,18) |
| InChIKey | OKLTZCWUIASYFI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|