C14H14ClF2NO5S — CID 8752923
[2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 8752923) has the molecular formula C14H14ClF2NO5S and a molecular weight of 381.78 g/mol. Its IUPAC name is [2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 8752923 |
| Molecular Formula | C14H14ClF2NO5S |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | [2-[[(3R)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@@]1(NC(=O)COC(=O)c2cc(F)c(F)cc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14ClF2NO5S/c1-14(2-3-24(21,22)7-14)18-12(19)6-23-13(20)8-4-10(16)11(17)5-9(8)15/h4-5H,2-3,6-7H2,1H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | GFZMEDRERUIIGA-CQSZACIVSA-N |
| XLogP | 1.47 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|