C19H18FNO5S — CID 6601805
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorobenzoyl)phenoxy]acetamide (PubChem CID 6601805) has the molecular formula C19H18FNO5S and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorobenzoyl)phenoxy]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorobenzoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 6601805 |
| Molecular Formula | C19H18FNO5S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[4-(4-fluorobenzoyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccc(F)cc2)cc1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H18FNO5S/c20-15-5-1-13(2-6-15)19(23)14-3-7-17(8-4-14)26-11-18(22)21-16-9-10-27(24,25)12-16/h1-8,16H,9-12H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | HRMZPSUSPSROBH-INIZCTEOSA-N |
| XLogP | 1.74 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |