C12H14ClNO4S — CID 4805342
2-(3-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 4805342) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 4805342 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClNO4S/c13-9-2-1-3-11(6-9)18-7-12(15)14-10-4-5-19(16,17)8-10/h1-3,6,10H,4-5,7-8H2,(H,14,15) |
| InChIKey | QDNNGWYMPRYAEF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |