C15H19ClN2O4S — CID 108950152
N-(3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide (PubChem CID 108950152) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide.
| Compound Name | N-(3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108950152 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-(3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
| SMILES | CCN(C(=O)CC(=O)Nc1cccc(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19ClN2O4S/c1-2-18(13-6-7-23(21,22)10-13)15(20)9-14(19)17-12-5-3-4-11(16)8-12/h3-5,8,13H,2,6-7,9-10H2,1H3,(H,17,19) |
| InChIKey | XFLRFKQWIBZHHJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|