C17H22N2O6S — CID 108950182
methyl 4-[[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-oxopropanoyl]amino]benzoate (PubChem CID 108950182) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is methyl 4-[[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 4-[[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108950182 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl 4-[[3-[(1,1-dioxothiolan-3-yl)-ethylamino]-3-oxopropanoyl]amino]benzoate |
| SMILES | CCN(C(=O)CC(=O)Nc1ccc(C(=O)OC)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22N2O6S/c1-3-19(14-8-9-26(23,24)11-14)16(21)10-15(20)18-13-6-4-12(5-7-13)17(22)25-2/h4-7,14H,3,8-11H2,1-2H3,(H,18,20) |
| InChIKey | MVLAIESWJSXWHG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|