C17H24N2O6S — CID 108950170
N-(2,5-dimethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide (PubChem CID 108950170) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108950170 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
| SMILES | CCN(C(=O)CC(=O)Nc1cc(OC)ccc1OC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O6S/c1-4-19(12-7-8-26(22,23)11-12)17(21)10-16(20)18-14-9-13(24-2)5-6-15(14)25-3/h5-6,9,12H,4,7-8,10-11H2,1-3H3,(H,18,20) |
| InChIKey | YTRZAWUGAZYHKB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|