C18H26N2O6S — CID 108949884
N-[(3,4-dimethoxyphenyl)methyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide (PubChem CID 108949884) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108949884 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
| SMILES | CCN(C(=O)CC(=O)NCc1ccc(OC)c(OC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26N2O6S/c1-4-20(14-7-8-27(23,24)12-14)18(22)10-17(21)19-11-13-5-6-15(25-2)16(9-13)26-3/h5-6,9,14H,4,7-8,10-12H2,1-3H3,(H,19,21) |
| InChIKey | ZBCQWBCAHURYBZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|