C17H23ClN2O4S — CID 108949775
N-[2-(4-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide (PubChem CID 108949775) has the molecular formula C17H23ClN2O4S and a molecular weight of 386.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108949775 |
| Molecular Formula | C17H23ClN2O4S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethylpropanediamide |
| SMILES | CCN(C(=O)CC(=O)NCCc1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23ClN2O4S/c1-2-20(15-8-10-25(23,24)12-15)17(22)11-16(21)19-9-7-13-3-5-14(18)6-4-13/h3-6,15H,2,7-12H2,1H3,(H,19,21) |
| InChIKey | LNCPKHMRGVSZPG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|