C18H26ClNO3S — CID 55776242
N-butyl-4-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)butanamide (PubChem CID 55776242) has the molecular formula C18H26ClNO3S and a molecular weight of 371.93 g/mol. Its IUPAC name is N-butyl-4-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)butanamide.
| Compound Name | N-butyl-4-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)butanamide |
|---|---|
| PubChem CID | 55776242 |
| Molecular Formula | C18H26ClNO3S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-butyl-4-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)butanamide |
| SMILES | CCCCN(C(=O)CCCc1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26ClNO3S/c1-2-3-12-20(17-11-13-24(22,23)14-17)18(21)6-4-5-15-7-9-16(19)10-8-15/h7-10,17H,2-6,11-14H2,1H3 |
| InChIKey | DBISUPPMGSVZFD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |