C19H27ClN2O4S — CID 55508109
3-acetamido-N-butyl-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 55508109) has the molecular formula C19H27ClN2O4S and a molecular weight of 414.96 g/mol. Its IUPAC name is 3-acetamido-N-butyl-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-acetamido-N-butyl-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 55508109 |
| Molecular Formula | C19H27ClN2O4S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-acetamido-N-butyl-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCCCN(C(=O)CC(NC(C)=O)c1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H27ClN2O4S/c1-3-4-10-22(17-9-11-27(25,26)13-17)19(24)12-18(21-14(2)23)15-5-7-16(20)8-6-15/h5-8,17-18H,3-4,9-13H2,1-2H3,(H,21,23) |
| InChIKey | PUKXUFXLKHOWSR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |