C19H29NO4S — CID 78767919
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(3-propan-2-ylphenoxy)acetamide (PubChem CID 78767919) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(3-propan-2-ylphenoxy)acetamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(3-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 78767919 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(3-propan-2-ylphenoxy)acetamide |
| SMILES | CCCCN(C(=O)COc1cccc(C(C)C)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H29NO4S/c1-4-5-10-20(17-9-11-25(22,23)14-17)19(21)13-24-18-8-6-7-16(12-18)15(2)3/h6-8,12,15,17H,4-5,9-11,13-14H2,1-3H3 |
| InChIKey | GWNZXNRSWPBAKP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |