C17H23NO5S — CID 55327740
2-(4-acetylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide (PubChem CID 55327740) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide |
|---|---|
| PubChem CID | 55327740 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-propylacetamide |
| SMILES | CCCN(C(=O)COc1ccc(C(C)=O)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23NO5S/c1-3-9-18(15-8-10-24(21,22)12-15)17(20)11-23-16-6-4-14(5-7-16)13(2)19/h4-7,15H,3,8-12H2,1-2H3 |
| InChIKey | JHTLDFYVXQMCIF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |