C16H24N2O3S2 — CID 8683186
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-propylthiourea (PubChem CID 8683186) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-propylthiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-propylthiourea |
|---|---|
| PubChem CID | 8683186 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-ethoxyphenyl)-1-propylthiourea |
| SMILES | CCCN(C(=S)Nc1ccc(OCC)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24N2O3S2/c1-3-10-18(14-9-11-23(19,20)12-14)16(22)17-13-5-7-15(8-6-13)21-4-2/h5-8,14H,3-4,9-12H2,1-2H3,(H,17,22)/t14-/m1/s1 |
| InChIKey | ROCGNHUQMXHISZ-CQSZACIVSA-N |
| XLogP | 2.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|