C12H20N2O4S3 — CID 3316245
3-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-propylthiourea (PubChem CID 3316245) has the molecular formula C12H20N2O4S3 and a molecular weight of 352.50 g/mol. Its IUPAC name is 3-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-propylthiourea.
| Compound Name | 3-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-propylthiourea |
|---|---|
| PubChem CID | 3316245 |
| Molecular Formula | C12H20N2O4S3 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-propylthiourea |
| SMILES | CCCN(C(=S)NC1=CCS(=O)(=O)C1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O4S3/c1-2-5-14(11-4-7-21(17,18)9-11)12(19)13-10-3-6-20(15,16)8-10/h3,11H,2,4-9H2,1H3,(H,13,19) |
| InChIKey | ZEFIMLOGEZIQJP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|