C14H20N2O2S2 — CID 8681117
1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(2-methylphenyl)thiourea (PubChem CID 8681117) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8681117 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(2-methylphenyl)thiourea |
| SMILES | CCN(C(=S)Nc1ccccc1C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20N2O2S2/c1-3-16(12-8-9-20(17,18)10-12)14(19)15-13-7-5-4-6-11(13)2/h4-7,12H,3,8-10H2,1-2H3,(H,15,19)/t12-/m0/s1 |
| InChIKey | CZCANJPDGJEDDK-LBPRGKRZSA-N |
| XLogP | 2.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|