C17H19ClN2O2S3 — CID 9232059
3-(3-chloro-2-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 9232059) has the molecular formula C17H19ClN2O2S3 and a molecular weight of 415.01 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9232059 |
| Molecular Formula | C17H19ClN2O2S3 |
| Molecular Weight | 415.01 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N(Cc1cccs1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H19ClN2O2S3/c1-12-15(18)5-2-6-16(12)19-17(23)20(10-14-4-3-8-24-14)13-7-9-25(21,22)11-13/h2-6,8,13H,7,9-11H2,1H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | FWGYVTXLASYVQM-CYBMUJFWSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|