C17H16Cl3NO4S2 — CID 43030960
N-(1,1-dioxothiolan-3-yl)-N-(thiophen-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 43030960) has the molecular formula C17H16Cl3NO4S2 and a molecular weight of 468.81 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-(thiophen-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-(thiophen-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 43030960 |
| Molecular Formula | C17H16Cl3NO4S2 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-(thiophen-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N(Cc1cccs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H16Cl3NO4S2/c18-13-6-15(20)16(7-14(13)19)25-9-17(22)21(8-12-2-1-4-26-12)11-3-5-27(23,24)10-11/h1-2,4,6-7,11H,3,5,8-10H2 |
| InChIKey | MQQLJYWIFHYCNE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|